C8H15N3OS — CID 105246868
[3-methoxy-1-(1,3-thiazol-5-yl)butan-2-yl]hydrazine (PubChem CID 105246868) has the molecular formula C8H15N3OS and a molecular weight of 201.29 g/mol. Its IUPAC name is [3-methoxy-1-(1,3-thiazol-5-yl)butan-2-yl]hydrazine.
| Compound Name | [3-methoxy-1-(1,3-thiazol-5-yl)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105246868 |
| Molecular Formula | C8H15N3OS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | [3-methoxy-1-(1,3-thiazol-5-yl)butan-2-yl]hydrazine |
| SMILES | COC(C)C(Cc1cncs1)NN |
| InChI | InChI=1S/C8H15N3OS/c1-6(12-2)8(11-9)3-7-4-10-5-13-7/h4-6,8,11H,3,9H2,1-2H3 |
| InChIKey | LGYGCKSZMJDKMB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|