C12H22N2OS — CID 116716182
3-methoxy-N-propyl-1-(1,3-thiazol-5-yl)pentan-2-amine (PubChem CID 116716182) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is 3-methoxy-N-propyl-1-(1,3-thiazol-5-yl)pentan-2-amine.
| Compound Name | 3-methoxy-N-propyl-1-(1,3-thiazol-5-yl)pentan-2-amine |
|---|---|
| PubChem CID | 116716182 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 3-methoxy-N-propyl-1-(1,3-thiazol-5-yl)pentan-2-amine |
| SMILES | CCCNC(Cc1cncs1)C(CC)OC |
| InChI | InChI=1S/C12H22N2OS/c1-4-6-14-11(12(5-2)15-3)7-10-8-13-9-16-10/h8-9,11-12,14H,4-7H2,1-3H3 |
| InChIKey | NSHOYDNGRWKZHB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |