C9H14F3N3OS — CID 103151746
[1-(1,3-thiazol-5-yl)-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine (PubChem CID 103151746) has the molecular formula C9H14F3N3OS and a molecular weight of 269.29 g/mol. Its IUPAC name is [1-(1,3-thiazol-5-yl)-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine.
| Compound Name | [1-(1,3-thiazol-5-yl)-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103151746 |
| Molecular Formula | C9H14F3N3OS |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | [1-(1,3-thiazol-5-yl)-4-(2,2,2-trifluoroethoxy)butan-2-yl]hydrazine |
| SMILES | NNC(CCOCC(F)(F)F)Cc1cncs1 |
| InChI | InChI=1S/C9H14F3N3OS/c10-9(11,12)5-16-2-1-7(15-13)3-8-4-14-6-17-8/h4,6-7,15H,1-3,5,13H2 |
| InChIKey | IYIPSUDQHJEQOV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|