C9H16F6N2O — CID 103151566
[7,7,7-trifluoro-1-(2,2,2-trifluoroethoxy)heptan-3-yl]hydrazine (PubChem CID 103151566) has the molecular formula C9H16F6N2O and a molecular weight of 282.23 g/mol. Its IUPAC name is [7,7,7-trifluoro-1-(2,2,2-trifluoroethoxy)heptan-3-yl]hydrazine.
| Compound Name | [7,7,7-trifluoro-1-(2,2,2-trifluoroethoxy)heptan-3-yl]hydrazine |
|---|---|
| PubChem CID | 103151566 |
| Molecular Formula | C9H16F6N2O |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | [7,7,7-trifluoro-1-(2,2,2-trifluoroethoxy)heptan-3-yl]hydrazine |
| SMILES | NNC(CCCC(F)(F)F)CCOCC(F)(F)F |
| InChI | InChI=1S/C9H16F6N2O/c10-8(11,12)4-1-2-7(17-16)3-5-18-6-9(13,14)15/h7,17H,1-6,16H2 |
| InChIKey | QFQAEYLRGFXHHG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|