C10H18N2O2S — CID 102927931
4-(2-methoxyethoxy)-1-(1,3-thiazol-5-yl)butan-2-amine (PubChem CID 102927931) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-1-(1,3-thiazol-5-yl)butan-2-amine.
| Compound Name | 4-(2-methoxyethoxy)-1-(1,3-thiazol-5-yl)butan-2-amine |
|---|---|
| PubChem CID | 102927931 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 4-(2-methoxyethoxy)-1-(1,3-thiazol-5-yl)butan-2-amine |
| SMILES | COCCOCCC(N)Cc1cncs1 |
| InChI | InChI=1S/C10H18N2O2S/c1-13-4-5-14-3-2-9(11)6-10-7-12-8-15-10/h7-9H,2-6,11H2,1H3 |
| InChIKey | PEPVTQMYHIZIRL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|