C10H16N2O2S — CID 116593776
3-amino-6-methoxy-1-(1,3-thiazol-5-yl)hexan-2-one (PubChem CID 116593776) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 3-amino-6-methoxy-1-(1,3-thiazol-5-yl)hexan-2-one.
| Compound Name | 3-amino-6-methoxy-1-(1,3-thiazol-5-yl)hexan-2-one |
|---|---|
| PubChem CID | 116593776 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 3-amino-6-methoxy-1-(1,3-thiazol-5-yl)hexan-2-one |
| SMILES | COCCCC(N)C(=O)Cc1cncs1 |
| InChI | InChI=1S/C10H16N2O2S/c1-14-4-2-3-9(11)10(13)5-8-6-12-7-15-8/h6-7,9H,2-5,11H2,1H3 |
| InChIKey | YRRLUVPPNJVSAR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|