C8H17NO3 — CID 116593700
3-amino-1,6-dimethoxyhexan-2-one (PubChem CID 116593700) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 3-amino-1,6-dimethoxyhexan-2-one.
| Compound Name | 3-amino-1,6-dimethoxyhexan-2-one |
|---|---|
| PubChem CID | 116593700 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 3-amino-1,6-dimethoxyhexan-2-one |
| SMILES | COCCCC(N)C(=O)COC |
| InChI | InChI=1S/C8H17NO3/c1-11-5-3-4-7(9)8(10)6-12-2/h7H,3-6,9H2,1-2H3 |
| InChIKey | QWJZIESTSJOCHR-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|