C8H11NO2S — CID 114854166
4-methoxy-1-(1,3-thiazol-5-yl)butan-1-one (PubChem CID 114854166) has the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. Its IUPAC name is 4-methoxy-1-(1,3-thiazol-5-yl)butan-1-one.
| Compound Name | 4-methoxy-1-(1,3-thiazol-5-yl)butan-1-one |
|---|---|
| PubChem CID | 114854166 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 4-methoxy-1-(1,3-thiazol-5-yl)butan-1-one |
| SMILES | COCCCC(=O)c1cncs1 |
| InChI | InChI=1S/C8H11NO2S/c1-11-4-2-3-7(10)8-5-9-6-12-8/h5-6H,2-4H2,1H3 |
| InChIKey | DMXRFEWCJQDJJT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|