C11H15N3OS — CID 105331967
[4-(furan-2-yl)-1-(1,3-thiazol-5-yl)butan-2-yl]hydrazine (PubChem CID 105331967) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is [4-(furan-2-yl)-1-(1,3-thiazol-5-yl)butan-2-yl]hydrazine.
| Compound Name | [4-(furan-2-yl)-1-(1,3-thiazol-5-yl)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105331967 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | [4-(furan-2-yl)-1-(1,3-thiazol-5-yl)butan-2-yl]hydrazine |
| SMILES | NNC(CCc1ccco1)Cc1cncs1 |
| InChI | InChI=1S/C11H15N3OS/c12-14-9(6-11-7-13-8-16-11)3-4-10-2-1-5-15-10/h1-2,5,7-9,14H,3-4,6,12H2 |
| InChIKey | VZDOUYZREFWYLD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|