C10H18N2O — CID 105282196
1-(furan-2-yl)hexan-3-ylhydrazine (PubChem CID 105282196) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 1-(furan-2-yl)hexan-3-ylhydrazine.
| Compound Name | 1-(furan-2-yl)hexan-3-ylhydrazine |
|---|---|
| PubChem CID | 105282196 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 1-(furan-2-yl)hexan-3-ylhydrazine |
| SMILES | CCCC(CCc1ccco1)NN |
| InChI | InChI=1S/C10H18N2O/c1-2-4-9(12-11)6-7-10-5-3-8-13-10/h3,5,8-9,12H,2,4,6-7,11H2,1H3 |
| InChIKey | IDTCUHQAJRBLRU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|