C12H12Br2N2OS — CID 107739564
2-[3,5-dibromo-4-(1,3-thiazol-5-ylmethoxy)phenyl]ethanamine (PubChem CID 107739564) has the molecular formula C12H12Br2N2OS and a molecular weight of 392.12 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-(1,3-thiazol-5-ylmethoxy)phenyl]ethanamine.
| Compound Name | 2-[3,5-dibromo-4-(1,3-thiazol-5-ylmethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 107739564 |
| Molecular Formula | C12H12Br2N2OS |
| Molecular Weight | 392.12 g/mol |
| Exact Mass | 389.90 |
| IUPAC Name | 2-[3,5-dibromo-4-(1,3-thiazol-5-ylmethoxy)phenyl]ethanamine |
| SMILES | NCCc1cc(Br)c(OCc2cncs2)c(Br)c1 |
| InChI | InChI=1S/C12H12Br2N2OS/c13-10-3-8(1-2-15)4-11(14)12(10)17-6-9-5-16-7-18-9/h3-5,7H,1-2,6,15H2 |
| InChIKey | WFWWYSVAKJYQHB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.12 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |