About 1-phosphorosooxy-2,3-di(propan-2-yl)benzene
1-phosphorosooxy-2,3-di(propan-2-yl)benzene (PubChem CID 141326845) has the molecular formula C12H17O2P
and a molecular weight of 224.24 g/mol. Its IUPAC name is 1-phosphorosooxy-2,3-di(propan-2-yl)benzene.
Molecular Properties
| Compound Name | 1-phosphorosooxy-2,3-di(propan-2-yl)benzene |
| PubChem CID | 141326845 |
| Molecular Formula | C12H17O2P |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-phosphorosooxy-2,3-di(propan-2-yl)benzene |
| SMILES | CC(C)c1cccc(OP=O)c1C(C)C |
| InChI | InChI=1S/C12H17O2P/c1-8(2)10-6-5-7-11(14-15-13)12(10)9(3)4/h5-9H,1-4H3 |
| InChIKey | SWWNHOYAKXWKAN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-phosphorosooxy-2,3-di(propan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phosphorosooxy-2,3-di(propan-2-yl)benzene?
The IUPAC name of 1-phosphorosooxy-2,3-di(propan-2-yl)benzene (CID 141326845) is 1-phosphorosooxy-2,3-di(propan-2-yl)benzene.
What is the SMILES notation for 1-phosphorosooxy-2,3-di(propan-2-yl)benzene?
The canonical SMILES for 1-phosphorosooxy-2,3-di(propan-2-yl)benzene is CC(C)c1cccc(OP=O)c1C(C)C.
What is the InChIKey of 1-phosphorosooxy-2,3-di(propan-2-yl)benzene?
The InChIKey is SWWNHOYAKXWKAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17O2P/c1-8(2)10-6-5-7-11(14-15-13)12(10)9(3)4/h5-9H,1-4H3.
What are the key properties of 1-phosphorosooxy-2,3-di(propan-2-yl)benzene?
1-phosphorosooxy-2,3-di(propan-2-yl)benzene has a molecular weight of 224.24 g/mol, XLogP of 4.52, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phosphorosooxy-2,3-di(propan-2-yl)benzene is sourced from PubChem (CID 141326845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).