C42H66O6 — CID 174849588
1-tert-butylperoxy-2,3-di(propan-2-yl)benzene;2-tert-butylperoxy-2-methylpropane;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene (PubChem CID 174849588) has the molecular formula C42H66O6 and a molecular weight of 666.98 g/mol. Its IUPAC name is 1-tert-butylperoxy-2,3-di(propan-2-yl)benzene;2-tert-butylperoxy-2-methylpropane;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene.
| Compound Name | 1-tert-butylperoxy-2,3-di(propan-2-yl)benzene;2-tert-butylperoxy-2-methylpropane;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene |
|---|---|
| PubChem CID | 174849588 |
| Molecular Formula | C42H66O6 |
| Molecular Weight | 666.98 g/mol |
| Exact Mass | 666.49 |
| IUPAC Name | 1-tert-butylperoxy-2,3-di(propan-2-yl)benzene;2-tert-butylperoxy-2-methylpropane;2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene |
| SMILES | CC(C)(C)OOC(C)(C)C.CC(C)(OOC(C)(C)c1ccccc1)c1ccccc1.CC(C)c1cccc(OOC(C)(C)C)c1C(C)C |
| InChI | InChI=1S/C18H22O2.C16H26O2.C8H18O2/c1-17(2,15-11-7-5-8-12-15)19-20-18(3,4)16-13-9-6-10-14-16;1-11(2)13-9-8-10-14(15(13)12(3)4)17-18-16(5,6)7;1-7(2,3)9-10-8(4,5)6/h5-14H,1-4H3;8-12H,1-7H3;1-6H3 |
| InChIKey | BGLYVAITKFROPS-UHFFFAOYSA-N |
| XLogP | 12.38 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.98 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|