C40H68O8 — CID 161027852
1,3-bis(2-tert-butylperoxypropan-2-yl)benzene (PubChem CID 161027852) has the molecular formula C40H68O8 and a molecular weight of 676.98 g/mol. Its IUPAC name is 1,3-bis(2-tert-butylperoxypropan-2-yl)benzene.
| Compound Name | 1,3-bis(2-tert-butylperoxypropan-2-yl)benzene |
|---|---|
| PubChem CID | 161027852 |
| Molecular Formula | C40H68O8 |
| Molecular Weight | 676.98 g/mol |
| Exact Mass | 676.49 |
| IUPAC Name | 1,3-bis(2-tert-butylperoxypropan-2-yl)benzene |
| SMILES | CC(C)(C)OOC(C)(C)c1cccc(C(C)(C)OOC(C)(C)C)c1.CC(C)(C)OOC(C)(C)c1cccc(C(C)(C)OOC(C)(C)C)c1 |
| InChI | InChI=1S/2C20H34O4/c2*1-17(2,3)21-23-19(7,8)15-12-11-13-16(14-15)20(9,10)24-22-18(4,5)6/h2*11-14H,1-10H3 |
| InChIKey | TZFOMNQCCPWXDV-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.98 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|