C20H38O2Si2 — CID 150405703
tert-butyl-[2-[3-(2-tert-butylsilyloxypropan-2-yl)phenyl]propan-2-yloxy]silane (PubChem CID 150405703) has the molecular formula C20H38O2Si2 and a molecular weight of 366.69 g/mol. Its IUPAC name is tert-butyl-[2-[3-(2-tert-butylsilyloxypropan-2-yl)phenyl]propan-2-yloxy]silane.
| Compound Name | tert-butyl-[2-[3-(2-tert-butylsilyloxypropan-2-yl)phenyl]propan-2-yloxy]silane |
|---|---|
| PubChem CID | 150405703 |
| Molecular Formula | C20H38O2Si2 |
| Molecular Weight | 366.69 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | tert-butyl-[2-[3-(2-tert-butylsilyloxypropan-2-yl)phenyl]propan-2-yloxy]silane |
| SMILES | CC(C)(C)[SiH2]OC(C)(C)c1cccc(C(C)(C)O[SiH2]C(C)(C)C)c1 |
| InChI | InChI=1S/C20H38O2Si2/c1-17(2,3)23-21-19(7,8)15-12-11-13-16(14-15)20(9,10)22-24-18(4,5)6/h11-14H,23-24H2,1-10H3 |
| InChIKey | HESFRGIQAIAPQU-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.69 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|