C12H20O4Si — CID 154430012
4-(2-tert-butylsilyloxypropan-2-yl)furan-2-carboxylic acid (PubChem CID 154430012) has the molecular formula C12H20O4Si and a molecular weight of 256.37 g/mol. Its IUPAC name is 4-(2-tert-butylsilyloxypropan-2-yl)furan-2-carboxylic acid.
| Compound Name | 4-(2-tert-butylsilyloxypropan-2-yl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 154430012 |
| Molecular Formula | C12H20O4Si |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 4-(2-tert-butylsilyloxypropan-2-yl)furan-2-carboxylic acid |
| SMILES | CC(C)(C)[SiH2]OC(C)(C)c1coc(C(=O)O)c1 |
| InChI | InChI=1S/C12H20O4Si/c1-11(2,3)17-16-12(4,5)8-6-9(10(13)14)15-7-8/h6-7H,17H2,1-5H3,(H,13,14) |
| InChIKey | HZBOSQUGFNPFDQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|