About CID 173166794
CID 173166794 (PubChem CID 173166794) has the molecular formula C10H13Se
and a molecular weight of 212.17 g/mol.
Molecular Properties
| Compound Name | CID 173166794 |
| PubChem CID | 173166794 |
| Molecular Formula | C10H13Se |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | — |
| SMILES | CC(C)c1ccccc1C[Se] |
| InChI | InChI=1S/C10H13Se/c1-8(2)10-6-4-3-5-9(10)7-11/h3-6,8H,7H2,1-2H3 |
| InChIKey | LDEJPBKGFSUKIP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 173166794 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173166794?
The IUPAC name of CID 173166794 (CID 173166794) is not available.
What is the SMILES notation for CID 173166794?
The canonical SMILES for CID 173166794 is CC(C)c1ccccc1C[Se].
What is the InChIKey of CID 173166794?
The InChIKey is LDEJPBKGFSUKIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Se/c1-8(2)10-6-4-3-5-9(10)7-11/h3-6,8H,7H2,1-2H3.
What are the key properties of CID 173166794?
CID 173166794 has a molecular weight of 212.17 g/mol, XLogP of 2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173166794 is sourced from PubChem (CID 173166794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).