About 1-(3,3-dimethylbutyl)-3-propan-2-yl-2-propylbenzene;ethane
1-(3,3-dimethylbutyl)-3-propan-2-yl-2-propylbenzene;ethane (PubChem CID 144751818) has the molecular formula C20H36
and a molecular weight of 276.51 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-3-propan-2-yl-2-propylbenzene;ethane.
Molecular Properties
| Compound Name | 1-(3,3-dimethylbutyl)-3-propan-2-yl-2-propylbenzene;ethane |
| PubChem CID | 144751818 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-3-propan-2-yl-2-propylbenzene;ethane |
| SMILES | CC.CCCc1c(CCC(C)(C)C)cccc1C(C)C |
| InChI | InChI=1S/C18H30.C2H6/c1-7-9-17-15(12-13-18(4,5)6)10-8-11-16(17)14(2)3;1-2/h8,10-11,14H,7,9,12-13H2,1-6H3;1-2H3 |
| InChIKey | CGPXQFFVHKMPIO-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(3,3-dimethylbutyl)-3-propan-2-yl-2-propylbenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethylbutyl)-3-propan-2-yl-2-propylbenzene;ethane?
The IUPAC name of 1-(3,3-dimethylbutyl)-3-propan-2-yl-2-propylbenzene;ethane (CID 144751818) is 1-(3,3-dimethylbutyl)-3-propan-2-yl-2-propylbenzene;ethane.
What is the SMILES notation for 1-(3,3-dimethylbutyl)-3-propan-2-yl-2-propylbenzene;ethane?
The canonical SMILES for 1-(3,3-dimethylbutyl)-3-propan-2-yl-2-propylbenzene;ethane is CC.CCCc1c(CCC(C)(C)C)cccc1C(C)C.
What is the InChIKey of 1-(3,3-dimethylbutyl)-3-propan-2-yl-2-propylbenzene;ethane?
The InChIKey is CGPXQFFVHKMPIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30.C2H6/c1-7-9-17-15(12-13-18(4,5)6)10-8-11-16(17)14(2)3;1-2/h8,10-11,14H,7,9,12-13H2,1-6H3;1-2H3.
What are the key properties of 1-(3,3-dimethylbutyl)-3-propan-2-yl-2-propylbenzene;ethane?
1-(3,3-dimethylbutyl)-3-propan-2-yl-2-propylbenzene;ethane has a molecular weight of 276.51 g/mol, XLogP of 6.77, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethylbutyl)-3-propan-2-yl-2-propylbenzene;ethane is sourced from PubChem (CID 144751818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).