C20H19NO4 — CID 70495321
2-(2-tert-butyl-6-methylphenyl)-1,3-dioxoisoindole-4-carboxylic acid (PubChem CID 70495321) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-(2-tert-butyl-6-methylphenyl)-1,3-dioxoisoindole-4-carboxylic acid.
| Compound Name | 2-(2-tert-butyl-6-methylphenyl)-1,3-dioxoisoindole-4-carboxylic acid |
|---|---|
| PubChem CID | 70495321 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-(2-tert-butyl-6-methylphenyl)-1,3-dioxoisoindole-4-carboxylic acid |
| SMILES | Cc1cccc(C(C)(C)C)c1N1C(=O)c2cccc(C(=O)O)c2C1=O |
| InChI | InChI=1S/C20H19NO4/c1-11-7-5-10-14(20(2,3)4)16(11)21-17(22)12-8-6-9-13(19(24)25)15(12)18(21)23/h5-10H,1-4H3,(H,24,25) |
| InChIKey | BNASEQXQOVUHKD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|