C16H23NO2S — CID 155653826
5-butyl-1,3-di(propan-2-yl)thieno[3,4-c]pyrrole-4,6-dione (PubChem CID 155653826) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is 5-butyl-1,3-di(propan-2-yl)thieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 5-butyl-1,3-di(propan-2-yl)thieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 155653826 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 5-butyl-1,3-di(propan-2-yl)thieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CCCCN1C(=O)c2c(C(C)C)sc(C(C)C)c2C1=O |
| InChI | InChI=1S/C16H23NO2S/c1-6-7-8-17-15(18)11-12(16(17)19)14(10(4)5)20-13(11)9(2)3/h9-10H,6-8H2,1-5H3 |
| InChIKey | LNOQCDWREURVRJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|