C24H18Br2N2O2 — CID 118972484
2-butyl-4-(3,6-dibromocarbazol-9-yl)isoindole-1,3-dione (PubChem CID 118972484) has the molecular formula C24H18Br2N2O2 and a molecular weight of 526.23 g/mol. Its IUPAC name is 2-butyl-4-(3,6-dibromocarbazol-9-yl)isoindole-1,3-dione.
| Compound Name | 2-butyl-4-(3,6-dibromocarbazol-9-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 118972484 |
| Molecular Formula | C24H18Br2N2O2 |
| Molecular Weight | 526.23 g/mol |
| Exact Mass | 523.97 |
| IUPAC Name | 2-butyl-4-(3,6-dibromocarbazol-9-yl)isoindole-1,3-dione |
| SMILES | CCCCN1C(=O)c2cccc(-n3c4ccc(Br)cc4c4cc(Br)ccc43)c2C1=O |
| InChI | InChI=1S/C24H18Br2N2O2/c1-2-3-11-27-23(29)16-5-4-6-21(22(16)24(27)30)28-19-9-7-14(25)12-17(19)18-13-15(26)8-10-20(18)28/h4-10,12-13H,2-3,11H2,1H3 |
| InChIKey | ZNLGUUKRBGLQCB-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.23 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|