C50H75NO2S3 — CID 123230443
1-[4,8-bis(3-ethylheptyl)-2-(2-methylbutan-2-yl)thieno[2,3-f][1]benzothiol-6-yl]-5-octyl-3-propan-2-ylthieno[3,4-c]pyrrole-4,6-dione (PubChem CID 123230443) has the molecular formula C50H75NO2S3 and a molecular weight of 818.36 g/mol. Its IUPAC name is 1-[4,8-bis(3-ethylheptyl)-2-(2-methylbutan-2-yl)thieno[2,3-f][1]benzothiol-6-yl]-5-octyl-3-propan-2-ylthieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 1-[4,8-bis(3-ethylheptyl)-2-(2-methylbutan-2-yl)thieno[2,3-f][1]benzothiol-6-yl]-5-octyl-3-propan-2-ylthieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 123230443 |
| Molecular Formula | C50H75NO2S3 |
| Molecular Weight | 818.36 g/mol |
| Exact Mass | 817.50 |
| IUPAC Name | 1-[4,8-bis(3-ethylheptyl)-2-(2-methylbutan-2-yl)thieno[2,3-f][1]benzothiol-6-yl]-5-octyl-3-propan-2-ylthieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CCCCCCCCN1C(=O)c2c(-c3cc4c(CCC(CC)CCCC)c5sc(C(C)(C)CC)cc5c(CCC(CC)CCCC)c4s3)sc(C(C)C)c2C1=O |
| InChI | InChI=1S/C50H75NO2S3/c1-11-17-20-21-22-23-30-51-48(52)42-43(49(51)53)47(56-44(42)33(7)8)40-31-38-36(28-26-34(14-4)24-18-12-2)46-39(32-41(55-46)50(9,10)16-6)37(45(38)54-40)29-27-35(15-5)25-19-13-3/h31-35H,11-30H2,1-10H3 |
| InChIKey | JLHWKAKGCDKYNW-UHFFFAOYSA-N |
| XLogP | 16.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.36 |
| LogP ≤ 5 | 16.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|