C12H15NO2S — CID 123154585
5-butyl-2-ethylthieno[2,3-c]pyrrole-4,6-dione (PubChem CID 123154585) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 5-butyl-2-ethylthieno[2,3-c]pyrrole-4,6-dione.
| Compound Name | 5-butyl-2-ethylthieno[2,3-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 123154585 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 5-butyl-2-ethylthieno[2,3-c]pyrrole-4,6-dione |
| SMILES | CCCCN1C(=O)c2cc(CC)sc2C1=O |
| InChI | InChI=1S/C12H15NO2S/c1-3-5-6-13-11(14)9-7-8(4-2)16-10(9)12(13)15/h7H,3-6H2,1-2H3 |
| InChIKey | KIEDDRUAXRMCQJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|