C22H17NO2S4 — CID 102204376
5-butyl-2-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thieno[2,3-c]pyrrole-4,6-dione (PubChem CID 102204376) has the molecular formula C22H17NO2S4 and a molecular weight of 455.65 g/mol. Its IUPAC name is 5-butyl-2-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thieno[2,3-c]pyrrole-4,6-dione.
| Compound Name | 5-butyl-2-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thieno[2,3-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 102204376 |
| Molecular Formula | C22H17NO2S4 |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.01 |
| IUPAC Name | 5-butyl-2-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]thieno[2,3-c]pyrrole-4,6-dione |
| SMILES | CCCCN1C(=O)c2cc(-c3ccc(-c4ccc(-c5cccs5)s4)s3)sc2C1=O |
| InChI | InChI=1S/C22H17NO2S4/c1-2-3-10-23-21(24)13-12-19(29-20(13)22(23)25)18-9-8-17(28-18)16-7-6-15(27-16)14-5-4-11-26-14/h4-9,11-12H,2-3,10H2,1H3 |
| InChIKey | NZKGPCKMOUCIEM-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|