C16H22NO4Si — CID 57006910
CID 57006910 (PubChem CID 57006910) has the molecular formula C16H22NO4Si and a molecular weight of 320.44 g/mol.
| Compound Name | CID 57006910 |
|---|---|
| PubChem CID | 57006910 |
| Molecular Formula | C16H22NO4Si |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | — |
| SMILES | CCCCN1C(=O)c2ccc([Si](OCC)OCC)cc2C1=O |
| InChI | InChI=1S/C16H22NO4Si/c1-4-7-10-17-15(18)13-9-8-12(11-14(13)16(17)19)22(20-5-2)21-6-3/h8-9,11H,4-7,10H2,1-3H3 |
| InChIKey | WXDDVSXDINHUIE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|