C36H48N2O2S6 — CID 140958644
(5Z)-3-decyl-5-[[5-[5-[(Z)-(3-decyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 140958644) has the molecular formula C36H48N2O2S6 and a molecular weight of 733.19 g/mol. Its IUPAC name is (5Z)-3-decyl-5-[[5-[5-[(Z)-(3-decyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-decyl-5-[[5-[5-[(Z)-(3-decyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 140958644 |
| Molecular Formula | C36H48N2O2S6 |
| Molecular Weight | 733.19 g/mol |
| Exact Mass | 732.20 |
| IUPAC Name | (5Z)-3-decyl-5-[[5-[5-[(Z)-(3-decyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]thiophen-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCCCCCCCN1C(=O)/C(=C/c2ccc(-c3ccc(/C=C4\SC(=S)N(CCCCCCCCCC)C4=O)s3)s2)SC1=S |
| InChI | InChI=1S/C36H48N2O2S6/c1-3-5-7-9-11-13-15-17-23-37-33(39)31(45-35(37)41)25-27-19-21-29(43-27)30-22-20-28(44-30)26-32-34(40)38(36(42)46-32)24-18-16-14-12-10-8-6-4-2/h19-22,25-26H,3-18,23-24H2,1-2H3/b31-25-,32-26- |
| InChIKey | DHOYICIVLUIDJG-WVMMTVHUSA-N |
| XLogP | 12.16 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.19 |
| LogP ≤ 5 | 12.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|