C33H44BrNO2S3 — CID 123264677
10-(5-bromothiophen-2-yl)-5-heptadecan-9-yl-8-(5-methylthiophen-2-yl)-3-oxa-9-thia-5-azatricyclo[5.3.0.02,4]deca-1(10),7-dien-6-one (PubChem CID 123264677) has the molecular formula C33H44BrNO2S3 and a molecular weight of 662.83 g/mol. Its IUPAC name is 10-(5-bromothiophen-2-yl)-5-heptadecan-9-yl-8-(5-methylthiophen-2-yl)-3-oxa-9-thia-5-azatricyclo[5.3.0.02,4]deca-1(10),7-dien-6-one.
| Compound Name | 10-(5-bromothiophen-2-yl)-5-heptadecan-9-yl-8-(5-methylthiophen-2-yl)-3-oxa-9-thia-5-azatricyclo[5.3.0.02,4]deca-1(10),7-dien-6-one |
|---|---|
| PubChem CID | 123264677 |
| Molecular Formula | C33H44BrNO2S3 |
| Molecular Weight | 662.83 g/mol |
| Exact Mass | 661.17 |
| IUPAC Name | 10-(5-bromothiophen-2-yl)-5-heptadecan-9-yl-8-(5-methylthiophen-2-yl)-3-oxa-9-thia-5-azatricyclo[5.3.0.02,4]deca-1(10),7-dien-6-one |
| SMILES | CCCCCCCCC(CCCCCCCC)N1C(=O)c2c(-c3ccc(C)s3)sc(-c3ccc(Br)s3)c2C2OC21 |
| InChI | InChI=1S/C33H44BrNO2S3/c1-4-6-8-10-12-14-16-23(17-15-13-11-9-7-5-2)35-32(36)28-27(29-33(35)37-29)30(25-20-21-26(34)39-25)40-31(28)24-19-18-22(3)38-24/h18-21,23,29,33H,4-17H2,1-3H3 |
| InChIKey | WTCGZEHEVAJELE-UHFFFAOYSA-N |
| XLogP | 12.00 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.83 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|