C21H31Br2NO2S — CID 90363217
1,3-dibromo-5-pentadecan-8-ylthieno[3,4-c]pyrrole-4,6-dione (PubChem CID 90363217) has the molecular formula C21H31Br2NO2S and a molecular weight of 521.36 g/mol. Its IUPAC name is 1,3-dibromo-5-pentadecan-8-ylthieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 1,3-dibromo-5-pentadecan-8-ylthieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 90363217 |
| Molecular Formula | C21H31Br2NO2S |
| Molecular Weight | 521.36 g/mol |
| Exact Mass | 519.04 |
| IUPAC Name | 1,3-dibromo-5-pentadecan-8-ylthieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CCCCCCCC(CCCCCCC)N1C(=O)c2c(Br)sc(Br)c2C1=O |
| InChI | InChI=1S/C21H31Br2NO2S/c1-3-5-7-9-11-13-15(14-12-10-8-6-4-2)24-20(25)16-17(21(24)26)19(23)27-18(16)22/h15H,3-14H2,1-2H3 |
| InChIKey | IEUUXFBVMGDNTG-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.36 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|