C26H34Br2O2S2 — CID 132965993
1,3-dibromo-5,7-dioctylthieno[3,4-f][2]benzothiole-4,8-dione (PubChem CID 132965993) has the molecular formula C26H34Br2O2S2 and a molecular weight of 602.50 g/mol. Its IUPAC name is 1,3-dibromo-5,7-dioctylthieno[3,4-f][2]benzothiole-4,8-dione.
| Compound Name | 1,3-dibromo-5,7-dioctylthieno[3,4-f][2]benzothiole-4,8-dione |
|---|---|
| PubChem CID | 132965993 |
| Molecular Formula | C26H34Br2O2S2 |
| Molecular Weight | 602.50 g/mol |
| Exact Mass | 600.04 |
| IUPAC Name | 1,3-dibromo-5,7-dioctylthieno[3,4-f][2]benzothiole-4,8-dione |
| SMILES | CCCCCCCCc1sc(CCCCCCCC)c2c1C(=O)c1c(Br)sc(Br)c1C2=O |
| InChI | InChI=1S/C26H34Br2O2S2/c1-3-5-7-9-11-13-15-17-19-20(18(31-17)16-14-12-10-8-6-4-2)24(30)22-21(23(19)29)25(27)32-26(22)28/h3-16H2,1-2H3 |
| InChIKey | JSJLRPWZDYXLQC-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.50 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|