C18H26Br2S2 — CID 67499277
4,6-dibromo-2-dodecylthieno[2,3-c]thiophene (PubChem CID 67499277) has the molecular formula C18H26Br2S2 and a molecular weight of 466.35 g/mol. Its IUPAC name is 4,6-dibromo-2-dodecylthieno[2,3-c]thiophene.
| Compound Name | 4,6-dibromo-2-dodecylthieno[2,3-c]thiophene |
|---|---|
| PubChem CID | 67499277 |
| Molecular Formula | C18H26Br2S2 |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 463.98 |
| IUPAC Name | 4,6-dibromo-2-dodecylthieno[2,3-c]thiophene |
| SMILES | CCCCCCCCCCCCc1cc2c(Br)sc(Br)c2s1 |
| InChI | InChI=1S/C18H26Br2S2/c1-2-3-4-5-6-7-8-9-10-11-12-14-13-15-16(21-14)18(20)22-17(15)19/h13H,2-12H2,1H3 |
| InChIKey | CIUIQZKGAFKVCF-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|