C15H19BrOS2 — CID 133083193
4-bromo-2-octylthieno[2,3-c]thiophene-6-carbaldehyde (PubChem CID 133083193) has the molecular formula C15H19BrOS2 and a molecular weight of 359.35 g/mol. Its IUPAC name is 4-bromo-2-octylthieno[2,3-c]thiophene-6-carbaldehyde.
| Compound Name | 4-bromo-2-octylthieno[2,3-c]thiophene-6-carbaldehyde |
|---|---|
| PubChem CID | 133083193 |
| Molecular Formula | C15H19BrOS2 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 4-bromo-2-octylthieno[2,3-c]thiophene-6-carbaldehyde |
| SMILES | CCCCCCCCc1cc2c(Br)sc(C=O)c2s1 |
| InChI | InChI=1S/C15H19BrOS2/c1-2-3-4-5-6-7-8-11-9-12-14(18-11)13(10-17)19-15(12)16/h9-10H,2-8H2,1H3 |
| InChIKey | BSMJWDJUHRIHDN-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|