C16H20S3 — CID 132606259
4,10-dibutyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 132606259) has the molecular formula C16H20S3 and a molecular weight of 308.54 g/mol. Its IUPAC name is 4,10-dibutyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 4,10-dibutyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 132606259 |
| Molecular Formula | C16H20S3 |
| Molecular Weight | 308.54 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 4,10-dibutyl-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | CCCCc1cc2sc3cc(CCCC)sc3c2s1 |
| InChI | InChI=1S/C16H20S3/c1-3-5-7-11-9-13-15(17-11)16-14(19-13)10-12(18-16)8-6-4-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | UUUVANBBDDJFNL-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.54 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |