C13H14S2 — CID 141472920
5-ethynyl-2-pentylthieno[3,2-b]thiophene (PubChem CID 141472920) has the molecular formula C13H14S2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 5-ethynyl-2-pentylthieno[3,2-b]thiophene.
| Compound Name | 5-ethynyl-2-pentylthieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 141472920 |
| Molecular Formula | C13H14S2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 5-ethynyl-2-pentylthieno[3,2-b]thiophene |
| SMILES | C#Cc1cc2sc(CCCCC)cc2s1 |
| InChI | InChI=1S/C13H14S2/c1-3-5-6-7-11-9-13-12(15-11)8-10(4-2)14-13/h2,8-9H,3,5-7H2,1H3 |
| InChIKey | ZQQBLIGEPGPANT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|