C20H26N2S2 — CID 70491130
5-pentyl-2-(2-pentylthieno[3,2-b]thiophen-5-yl)pyrimidine (PubChem CID 70491130) has the molecular formula C20H26N2S2 and a molecular weight of 358.58 g/mol. Its IUPAC name is 5-pentyl-2-(2-pentylthieno[3,2-b]thiophen-5-yl)pyrimidine.
| Compound Name | 5-pentyl-2-(2-pentylthieno[3,2-b]thiophen-5-yl)pyrimidine |
|---|---|
| PubChem CID | 70491130 |
| Molecular Formula | C20H26N2S2 |
| Molecular Weight | 358.58 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 5-pentyl-2-(2-pentylthieno[3,2-b]thiophen-5-yl)pyrimidine |
| SMILES | CCCCCc1cnc(-c2cc3sc(CCCCC)cc3s2)nc1 |
| InChI | InChI=1S/C20H26N2S2/c1-3-5-7-9-15-13-21-20(22-14-15)19-12-18-17(24-19)11-16(23-18)10-8-6-4-2/h11-14H,3-10H2,1-2H3 |
| InChIKey | ZAEPGGPHNOOGTR-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.58 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|