C14H18S2 — CID 141281764
5-ethenyl-2-hexylthieno[3,2-b]thiophene (PubChem CID 141281764) has the molecular formula C14H18S2 and a molecular weight of 250.43 g/mol. Its IUPAC name is 5-ethenyl-2-hexylthieno[3,2-b]thiophene.
| Compound Name | 5-ethenyl-2-hexylthieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 141281764 |
| Molecular Formula | C14H18S2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 5-ethenyl-2-hexylthieno[3,2-b]thiophene |
| SMILES | C=Cc1cc2sc(CCCCCC)cc2s1 |
| InChI | InChI=1S/C14H18S2/c1-3-5-6-7-8-12-10-14-13(16-12)9-11(4-2)15-14/h4,9-10H,2-3,5-8H2,1H3 |
| InChIKey | SIOACLINDLPRQU-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|