C19H30S2 — CID 173421142
2-heptyl-5-hexan-2-ylthieno[3,2-b]thiophene (PubChem CID 173421142) has the molecular formula C19H30S2 and a molecular weight of 322.58 g/mol. Its IUPAC name is 2-heptyl-5-hexan-2-ylthieno[3,2-b]thiophene.
| Compound Name | 2-heptyl-5-hexan-2-ylthieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 173421142 |
| Molecular Formula | C19H30S2 |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-heptyl-5-hexan-2-ylthieno[3,2-b]thiophene |
| SMILES | CCCCCCCc1cc2sc(C(C)CCCC)cc2s1 |
| InChI | InChI=1S/C19H30S2/c1-4-6-8-9-10-12-16-13-18-19(20-16)14-17(21-18)15(3)11-7-5-2/h13-15H,4-12H2,1-3H3 |
| InChIKey | UTPRSGNSAGBJLG-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|