C14H19BrS2 — CID 135070013
3-bromo-5-octylthieno[3,2-b]thiophene (PubChem CID 135070013) has the molecular formula C14H19BrS2 and a molecular weight of 331.34 g/mol. Its IUPAC name is 3-bromo-5-octylthieno[3,2-b]thiophene.
| Compound Name | 3-bromo-5-octylthieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 135070013 |
| Molecular Formula | C14H19BrS2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 3-bromo-5-octylthieno[3,2-b]thiophene |
| SMILES | CCCCCCCCc1cc2scc(Br)c2s1 |
| InChI | InChI=1S/C14H19BrS2/c1-2-3-4-5-6-7-8-11-9-13-14(17-11)12(15)10-16-13/h9-10H,2-8H2,1H3 |
| InChIKey | SOIYUIQUDYKTMA-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|