C36H38N4S2 — CID 126552318
2-[10-(dicyanomethylidene)-2,7-dioctyl-[1]benzothiolo[7,6-g][1]benzothiol-5-ylidene]propanedinitrile (PubChem CID 126552318) has the molecular formula C36H38N4S2 and a molecular weight of 590.86 g/mol. Its IUPAC name is 2-[10-(dicyanomethylidene)-2,7-dioctyl-[1]benzothiolo[7,6-g][1]benzothiol-5-ylidene]propanedinitrile.
| Compound Name | 2-[10-(dicyanomethylidene)-2,7-dioctyl-[1]benzothiolo[7,6-g][1]benzothiol-5-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 126552318 |
| Molecular Formula | C36H38N4S2 |
| Molecular Weight | 590.86 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | 2-[10-(dicyanomethylidene)-2,7-dioctyl-[1]benzothiolo[7,6-g][1]benzothiol-5-ylidene]propanedinitrile |
| SMILES | CCCCCCCCc1cc2c(=C(C#N)C#N)cc3c(cc(=C(C#N)C#N)c4cc(CCCCCCCC)sc43)c2s1 |
| InChI | InChI=1S/C36H38N4S2/c1-3-5-7-9-11-13-15-27-17-31-29(25(21-37)22-38)19-34-33(35(31)41-27)20-30(26(23-39)24-40)32-18-28(42-36(32)34)16-14-12-10-8-6-4-2/h17-20H,3-16H2,1-2H3 |
| InChIKey | BAEZDRPHTRTITG-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.86 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|