C36H30N4S4 — CID 102371903
2-[4-[7-(dicyanomethylidene)-10-hexyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-10-hexyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene]propanedinitrile (PubChem CID 102371903) has the molecular formula C36H30N4S4 and a molecular weight of 646.93 g/mol. Its IUPAC name is 2-[4-[7-(dicyanomethylidene)-10-hexyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-10-hexyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene]propanedinitrile.
| Compound Name | 2-[4-[7-(dicyanomethylidene)-10-hexyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-10-hexyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 102371903 |
| Molecular Formula | C36H30N4S4 |
| Molecular Weight | 646.93 g/mol |
| Exact Mass | 646.14 |
| IUPAC Name | 2-[4-[7-(dicyanomethylidene)-10-hexyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-10-hexyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-7-ylidene]propanedinitrile |
| SMILES | CCCCCCc1cc2c(s1)-c1sc(-c3cc4c(s3)-c3sc(CCCCCC)cc3C4=C(C#N)C#N)cc1C2=C(C#N)C#N |
| InChI | InChI=1S/C36H30N4S4/c1-3-5-7-9-11-23-13-25-31(21(17-37)18-38)27-15-29(43-35(27)33(25)41-23)30-16-28-32(22(19-39)20-40)26-14-24(12-10-8-6-4-2)42-34(26)36(28)44-30/h13-16H,3-12H2,1-2H3 |
| InChIKey | NQWMUZGVZXYPMT-UHFFFAOYSA-N |
| XLogP | 11.50 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.93 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|