C36H38N4OS — CID 123437871
(2Z)-2-[(5E)-5-[cyano(isocyano)methylidene]-2,7-dioctyl-[1]benzothiolo[7,6-g][1]benzofuran-10-ylidene]-2-isocyanoacetonitrile (PubChem CID 123437871) has the molecular formula C36H38N4OS and a molecular weight of 574.79 g/mol. Its IUPAC name is (2Z)-2-[(5E)-5-[cyano(isocyano)methylidene]-2,7-dioctyl-[1]benzothiolo[7,6-g][1]benzofuran-10-ylidene]-2-isocyanoacetonitrile.
| Compound Name | (2Z)-2-[(5E)-5-[cyano(isocyano)methylidene]-2,7-dioctyl-[1]benzothiolo[7,6-g][1]benzofuran-10-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 123437871 |
| Molecular Formula | C36H38N4OS |
| Molecular Weight | 574.79 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | (2Z)-2-[(5E)-5-[cyano(isocyano)methylidene]-2,7-dioctyl-[1]benzothiolo[7,6-g][1]benzofuran-10-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=c1/cc2c(c/c(=C(/C#N)[N+]#[C-])c3cc(CCCCCCCC)sc32)c2oc(CCCCCCCC)cc12 |
| InChI | InChI=1S/C36H38N4OS/c1-5-7-9-11-13-15-17-25-19-29-27(33(23-37)39-3)22-32-30(35(29)41-25)21-28(34(24-38)40-4)31-20-26(42-36(31)32)18-16-14-12-10-8-6-2/h19-22H,5-18H2,1-2H3/b33-27-,34-28+ |
| InChIKey | YKPSUVQCGGKGGA-DENOHBPFSA-N |
| XLogP | 9.71 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.79 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|