C52H55NOS4 — CID 59582557
5-[5-[7,7-dioctyl-10-[4-(N-phenylanilino)phenyl]-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]thiophene-2-carbaldehyde (PubChem CID 59582557) has the molecular formula C52H55NOS4 and a molecular weight of 838.29 g/mol. Its IUPAC name is 5-[5-[7,7-dioctyl-10-[4-(N-phenylanilino)phenyl]-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[5-[7,7-dioctyl-10-[4-(N-phenylanilino)phenyl]-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 59582557 |
| Molecular Formula | C52H55NOS4 |
| Molecular Weight | 838.29 g/mol |
| Exact Mass | 837.32 |
| IUPAC Name | 5-[5-[7,7-dioctyl-10-[4-(N-phenylanilino)phenyl]-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]thiophen-2-yl]thiophene-2-carbaldehyde |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)sc2-c2sc(-c3ccc(-c4ccc(C=O)s4)s3)cc21 |
| InChI | InChI=1S/C52H55NOS4/c1-3-5-7-9-11-19-33-52(34-20-12-10-8-6-4-2)43-35-48(38-25-27-41(28-26-38)53(39-21-15-13-16-22-39)40-23-17-14-18-24-40)57-50(43)51-44(52)36-49(58-51)47-32-31-46(56-47)45-30-29-42(37-54)55-45/h13-18,21-32,35-37H,3-12,19-20,33-34H2,1-2H3 |
| InChIKey | DZWANCBXQKVWMU-UHFFFAOYSA-N |
| XLogP | 17.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.29 |
| LogP ≤ 5 | 17.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|