C60H64N2O4S — CID 155928330
5-[4-[5,11-bis(2-ethylhexyl)-12-[4-(3,4,5-trimethoxyphenyl)phenyl]indolo[3,2-b]carbazol-6-yl]phenyl]thiophene-2-carbaldehyde (PubChem CID 155928330) has the molecular formula C60H64N2O4S and a molecular weight of 909.25 g/mol. Its IUPAC name is 5-[4-[5,11-bis(2-ethylhexyl)-12-[4-(3,4,5-trimethoxyphenyl)phenyl]indolo[3,2-b]carbazol-6-yl]phenyl]thiophene-2-carbaldehyde.
| Compound Name | 5-[4-[5,11-bis(2-ethylhexyl)-12-[4-(3,4,5-trimethoxyphenyl)phenyl]indolo[3,2-b]carbazol-6-yl]phenyl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 155928330 |
| Molecular Formula | C60H64N2O4S |
| Molecular Weight | 909.25 g/mol |
| Exact Mass | 908.46 |
| IUPAC Name | 5-[4-[5,11-bis(2-ethylhexyl)-12-[4-(3,4,5-trimethoxyphenyl)phenyl]indolo[3,2-b]carbazol-6-yl]phenyl]thiophene-2-carbaldehyde |
| SMILES | CCCCC(CC)Cn1c2ccccc2c2c(-c3ccc(-c4ccc(C=O)s4)cc3)c3c(c(-c4ccc(-c5cc(OC)c(OC)c(OC)c5)cc4)c21)c1ccccc1n3CC(CC)CCCC |
| InChI | InChI=1S/C60H64N2O4S/c1-8-12-18-39(10-3)36-61-50-23-17-15-21-48(50)57-55(44-30-26-42(27-31-44)53-33-32-46(38-63)67-53)59-56(47-20-14-16-22-49(47)62(59)37-40(11-4)19-13-9-2)54(58(57)61)43-28-24-41(25-29-43)45-34-51(64-5)60(66-7)52(35-45)65-6/h14-17,20-35,38-40H,8-13,18-19,36-37H2,1-7H3 |
| InChIKey | NVGUNPXGUFBIET-UHFFFAOYSA-N |
| XLogP | 16.90 |
| TPSA | 54.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.25 |
| LogP ≤ 5 | 16.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|