C24H31NOS — CID 170838393
5-[4-(2-ethylhexyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]thiophene-2-carbaldehyde (PubChem CID 170838393) has the molecular formula C24H31NOS and a molecular weight of 381.59 g/mol. Its IUPAC name is 5-[4-(2-ethylhexyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[4-(2-ethylhexyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 170838393 |
| Molecular Formula | C24H31NOS |
| Molecular Weight | 381.59 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 5-[4-(2-ethylhexyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]thiophene-2-carbaldehyde |
| SMILES | CCCCC(CC)CN1c2ccc(-c3ccc(C=O)s3)cc2C2CCCC21 |
| InChI | InChI=1S/C24H31NOS/c1-3-5-7-17(4-2)15-25-22-9-6-8-20(22)21-14-18(10-12-23(21)25)24-13-11-19(16-26)27-24/h10-14,16-17,20,22H,3-9,15H2,1-2H3 |
| InChIKey | JPEABRCYBQDJCM-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.59 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|