C42H53NO2S3 — CID 139262742
5-[10-(2-ethylhexyl)-7-(5-formyl-4-hexylthiophen-2-yl)phenothiazin-3-yl]-3-hexylthiophene-2-carbaldehyde (PubChem CID 139262742) has the molecular formula C42H53NO2S3 and a molecular weight of 700.09 g/mol. Its IUPAC name is 5-[10-(2-ethylhexyl)-7-(5-formyl-4-hexylthiophen-2-yl)phenothiazin-3-yl]-3-hexylthiophene-2-carbaldehyde.
| Compound Name | 5-[10-(2-ethylhexyl)-7-(5-formyl-4-hexylthiophen-2-yl)phenothiazin-3-yl]-3-hexylthiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 139262742 |
| Molecular Formula | C42H53NO2S3 |
| Molecular Weight | 700.09 g/mol |
| Exact Mass | 699.32 |
| IUPAC Name | 5-[10-(2-ethylhexyl)-7-(5-formyl-4-hexylthiophen-2-yl)phenothiazin-3-yl]-3-hexylthiophene-2-carbaldehyde |
| SMILES | CCCCCCc1cc(-c2ccc3c(c2)Sc2cc(-c4cc(CCCCCC)c(C=O)s4)ccc2N3CC(CC)CCCC)sc1C=O |
| InChI | InChI=1S/C42H53NO2S3/c1-5-9-12-14-17-31-23-37(46-41(31)28-44)33-19-21-35-39(25-33)48-40-26-34(20-22-36(40)43(35)27-30(8-4)16-11-7-3)38-24-32(42(29-45)47-38)18-15-13-10-6-2/h19-26,28-30H,5-18,27H2,1-4H3 |
| InChIKey | XBGYKJBZWINVFH-UHFFFAOYSA-N |
| XLogP | 13.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.09 |
| LogP ≤ 5 | 13.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|