C20H23Br2NS — CID 71356385
3,7-dibromo-10-(2-ethylhexyl)phenothiazine (PubChem CID 71356385) has the molecular formula C20H23Br2NS and a molecular weight of 469.29 g/mol. Its IUPAC name is 3,7-dibromo-10-(2-ethylhexyl)phenothiazine.
| Compound Name | 3,7-dibromo-10-(2-ethylhexyl)phenothiazine |
|---|---|
| PubChem CID | 71356385 |
| Molecular Formula | C20H23Br2NS |
| Molecular Weight | 469.29 g/mol |
| Exact Mass | 466.99 |
| IUPAC Name | 3,7-dibromo-10-(2-ethylhexyl)phenothiazine |
| SMILES | CCCCC(CC)CN1c2ccc(Br)cc2Sc2cc(Br)ccc21 |
| InChI | InChI=1S/C20H23Br2NS/c1-3-5-6-14(4-2)13-23-17-9-7-15(21)11-19(17)24-20-12-16(22)8-10-18(20)23/h7-12,14H,3-6,13H2,1-2H3 |
| InChIKey | BKMNQLRBGNJKPI-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.29 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |