C40H29KN2O4 — CID 166748326
potassium 4-[4-[1,3-dioxo-6-[4-(N-phenylanilino)phenyl]benzo[de]isoquinolin-2-yl]phenyl]butanoate (PubChem CID 166748326) has the molecular formula C40H29KN2O4 and a molecular weight of 640.78 g/mol. Its IUPAC name is potassium 4-[4-[1,3-dioxo-6-[4-(N-phenylanilino)phenyl]benzo[de]isoquinolin-2-yl]phenyl]butanoate.
| Compound Name | potassium 4-[4-[1,3-dioxo-6-[4-(N-phenylanilino)phenyl]benzo[de]isoquinolin-2-yl]phenyl]butanoate |
|---|---|
| PubChem CID | 166748326 |
| Molecular Formula | C40H29KN2O4 |
| Molecular Weight | 640.78 g/mol |
| Exact Mass | 640.18 |
| IUPAC Name | potassium 4-[4-[1,3-dioxo-6-[4-(N-phenylanilino)phenyl]benzo[de]isoquinolin-2-yl]phenyl]butanoate |
| SMILES | O=C([O-])CCCc1ccc(N2C(=O)c3cccc4c(-c5ccc(N(c6ccccc6)c6ccccc6)cc5)ccc(c34)C2=O)cc1.[K+] |
| InChI | InChI=1S/C40H30N2O4.K/c43-37(44)16-7-9-27-17-21-32(22-18-27)42-39(45)35-15-8-14-34-33(25-26-36(38(34)35)40(42)46)28-19-23-31(24-20-28)41(29-10-3-1-4-11-29)30-12-5-2-6-13-30;/h1-6,8,10-15,17-26H,7,9,16H2,(H,43,44);/q;+1/p-1 |
| InChIKey | AOZHWYYHNXOEAB-UHFFFAOYSA-M |
| XLogP | 4.85 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.78 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|