C33H25N3O — CID 67819435
4-[2-oxo-6-[4-(N-phenylanilino)phenyl]benzo[cd]indol-1-yl]butanenitrile (PubChem CID 67819435) has the molecular formula C33H25N3O and a molecular weight of 479.58 g/mol. Its IUPAC name is 4-[2-oxo-6-[4-(N-phenylanilino)phenyl]benzo[cd]indol-1-yl]butanenitrile.
| Compound Name | 4-[2-oxo-6-[4-(N-phenylanilino)phenyl]benzo[cd]indol-1-yl]butanenitrile |
|---|---|
| PubChem CID | 67819435 |
| Molecular Formula | C33H25N3O |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 4-[2-oxo-6-[4-(N-phenylanilino)phenyl]benzo[cd]indol-1-yl]butanenitrile |
| SMILES | N#CCCCN1C(=O)c2cccc3c(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)ccc1c23 |
| InChI | InChI=1S/C33H25N3O/c34-22-7-8-23-35-31-21-20-28(29-14-9-15-30(32(29)31)33(35)37)24-16-18-27(19-17-24)36(25-10-3-1-4-11-25)26-12-5-2-6-13-26/h1-6,9-21H,7-8,23H2 |
| InChIKey | AUXAHOGKRQSYIK-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|