C25H16F3NO — CID 67819457
1-benzyl-6-[4-(trifluoromethyl)phenyl]benzo[cd]indol-2-one (PubChem CID 67819457) has the molecular formula C25H16F3NO and a molecular weight of 403.40 g/mol. Its IUPAC name is 1-benzyl-6-[4-(trifluoromethyl)phenyl]benzo[cd]indol-2-one.
| Compound Name | 1-benzyl-6-[4-(trifluoromethyl)phenyl]benzo[cd]indol-2-one |
|---|---|
| PubChem CID | 67819457 |
| Molecular Formula | C25H16F3NO |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 1-benzyl-6-[4-(trifluoromethyl)phenyl]benzo[cd]indol-2-one |
| SMILES | O=C1c2cccc3c(-c4ccc(C(F)(F)F)cc4)ccc(c23)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H16F3NO/c26-25(27,28)18-11-9-17(10-12-18)19-13-14-22-23-20(19)7-4-8-21(23)24(30)29(22)15-16-5-2-1-3-6-16/h1-14H,15H2 |
| InChIKey | CQVZGNKDDBPXLQ-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |