C22H18N2O — CID 58320729
1-(3-isocyanopropyl)-6-(4-methylphenyl)benzo[cd]indol-2-one (PubChem CID 58320729) has the molecular formula C22H18N2O and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-(3-isocyanopropyl)-6-(4-methylphenyl)benzo[cd]indol-2-one.
| Compound Name | 1-(3-isocyanopropyl)-6-(4-methylphenyl)benzo[cd]indol-2-one |
|---|---|
| PubChem CID | 58320729 |
| Molecular Formula | C22H18N2O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 1-(3-isocyanopropyl)-6-(4-methylphenyl)benzo[cd]indol-2-one |
| SMILES | [C-]#[N+]CCCN1C(=O)c2cccc3c(-c4ccc(C)cc4)ccc1c23 |
| InChI | InChI=1S/C22H18N2O/c1-15-7-9-16(10-8-15)17-11-12-20-21-18(17)5-3-6-19(21)22(25)24(20)14-4-13-23-2/h3,5-12H,4,13-14H2,1H3 |
| InChIKey | ZXOMEOONIPNMRB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 24.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|