C23H26N2O5 — CID 101109209
6,12-bis(5-hydroxypentyl)-6,12-diazatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7,13-trione (PubChem CID 101109209) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is 6,12-bis(5-hydroxypentyl)-6,12-diazatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7,13-trione.
| Compound Name | 6,12-bis(5-hydroxypentyl)-6,12-diazatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7,13-trione |
|---|---|
| PubChem CID | 101109209 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 6,12-bis(5-hydroxypentyl)-6,12-diazatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaene-5,7,13-trione |
| SMILES | O=C1c2ccc3c4c(ccc(c24)C(=O)N1CCCCCO)N(CCCCCO)C3=O |
| InChI | InChI=1S/C23H26N2O5/c26-13-5-1-3-11-24-18-10-9-16-19-15(7-8-17(20(18)19)21(24)28)22(29)25(23(16)30)12-4-2-6-14-27/h7-10,26-27H,1-6,11-14H2 |
| InChIKey | QYWPNVRSPSKXMW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|